H-Asp(OBut)-ObutHCL structure
|
Common Name | H-Asp(OBut)-ObutHCL | ||
|---|---|---|---|---|
| CAS Number | 1791-13-5 | Molecular Weight | 281.776 | |
| Density | N/A | Boiling Point | 339.8ºC at 760 mmHg | |
| Molecular Formula | C12H24ClNO4 | Melting Point | 150 °C(dec.) | |
| MSDS | Chinese USA | Flash Point | 159.3ºC | |
Use of H-Asp(OBut)-ObutHCLH-Asp(OtBu)-OtBu.HCl is an aspartic acid derivative[1]. |
| Name | ditert-butyl (2S)-2-aminobutanedioate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | H-Asp(OtBu)-OtBu.HCl is an aspartic acid derivative[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Amino acids and amino acid derivatives have been commercially used as ergogenic supplements. They influence the secretion of anabolic hormones, supply of fuel during exercise, mental performance during stress related tasks and prevent exercise induced muscle damage. They are recognized to be beneficial as ergogenic dietary substances[1]. |
| References |
| Boiling Point | 339.8ºC at 760 mmHg |
|---|---|
| Melting Point | 150 °C(dec.) |
| Molecular Formula | C12H24ClNO4 |
| Molecular Weight | 281.776 |
| Flash Point | 159.3ºC |
| Exact Mass | 281.139374 |
| PSA | 78.62000 |
| LogP | 2.88950 |
| Vapour Pressure | 6.39E-05mmHg at 25°C |
| InChIKey | GVLZIMQSYQDAHB-QRPNPIFTSA-N |
| SMILES | CC(C)(C)OC(=O)CC(N)C(=O)OC(C)(C)C.Cl |
| Storage condition | −20°C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922499990 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
|
Convulsant properties of L-glutamic acid di-tert butyl ester.
Neurobehav. Toxicol. Teratol. 7 , 275-278, (1985) Glutamic acid di-tert butyl ester (GTBE) was found to have a pronounced convulsant effect in mice and rats, producing recurrent clonic convulsions combined with postural and respiratory disturbances i... |
| L-Aspartic acid, bis(1,1-dimethylethyl) ester, hydrochloride (1:1) |
| H-Asp(OtBu)-OtBu,HCl |
| aspartic acid di-t-butyl ester hydrochloride |
| (S)-Di-tert-butyl 2-aminosuccinate hydrochloride |
| H-Asp(OtBu)-OtBu·HCl |
| di-t-Bu-L-aspartic acid |
| L-Aspartic Acid Di-tert-butyl Ester Hydrochloride |
| Bis(2-methyl-2-propanyl) L-aspartate hydrochloride (1:1) |
| Di-tert-butyl L-aspartate hydrochloride (1:1) |
| Di-tert-butyl L-Aspartate Hydrochloride |
| aspartic acid di-tert-butyl ester hydrochloride |
| H-Asp(OtBu)-OtBu.HCl |
| H-Asp(OBut)-ObutHCL |