4-bromo-5-((4-hydroxyphenethylamino)Methyl)-2-Methoxyphenol structure
|
Common Name | 4-bromo-5-((4-hydroxyphenethylamino)Methyl)-2-Methoxyphenol | ||
|---|---|---|---|---|
| CAS Number | 179107-93-8 | Molecular Weight | 352.223 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 503.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H18BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.2±28.7 °C | |
| Name | 4-bromo-5-[[2-(4-hydroxyphenyl)ethylamino]methyl]-2-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 503.3±45.0 °C at 760 mmHg |
| Molecular Formula | C16H18BrNO3 |
| Molecular Weight | 352.223 |
| Flash Point | 258.2±28.7 °C |
| Exact Mass | 351.046997 |
| PSA | 61.72000 |
| LogP | 2.94 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | JBFKJIRYXUAQSW-UHFFFAOYSA-N |
| SMILES | COc1cc(Br)c(CNCCc2ccc(O)cc2)cc1O |
|
~92%
4-bromo-5-((4-h... CAS#:179107-93-8 |
| Literature: Sanochemia Pharmazeutica Patent: US6369238 B1, 2002 ; Location in patent: Example 4 ; |
|
~%
4-bromo-5-((4-h... CAS#:179107-93-8 |
| Literature: Kueenburg, Bernhard; Czollner, Laszlo; Frohlich, Johannes; Jordis, Ulrich Organic Process Research and Development, 1999 , vol. 3, # 6 p. 425 - 431 |
|
~%
4-bromo-5-((4-h... CAS#:179107-93-8 |
| Literature: Kueenburg, Bernhard; Czollner, Laszlo; Frohlich, Johannes; Jordis, Ulrich Organic Process Research and Development, 1999 , vol. 3, # 6 p. 425 - 431 |
|
~%
4-bromo-5-((4-h... CAS#:179107-93-8 |
| Literature: Czollner, Laszlo; Frantsits, Werner; Kueenburg, Bernhard; Hedenig, Ursula; Froehlich, Johannes; Jordis, Ulrich Tetrahedron Letters, 1998 , vol. 39, # 15 p. 2087 - 2088 |
| Phenol, 4-bromo-5-[[[2-(4-hydroxyphenyl)ethyl]amino]methyl]-2-methoxy- |
| 4-bromo-5-((4-hydroxyphenethylamino)methyl)-2-methoxyphenol |
| PHENOL,4-BROMO-5-[[[2-(4-HYDROXYPHENYL)ETHYL]AMINO]METHYL]-2-METHOXY |
| (2-bromo-5-hydroxy-4-methoxybenzyl)-2-(4-hydroxyphenyl)ethylamine |
| N-(2-bromo-5-hydroxy-4-methoxybenzyl)-4-hydroxyphenethylamine |
| N-(2-BROMO-4-METHOXY-5-HYDROXYBENZYL)-4-HYDROXYPHENETHYLAMINE |
| N-(4-hydroxyphenethyl)-(6-bromo-3-hydroxy-4-methoxy)benzylamine |
| 4-Bromo-5-({[2-(4-hydroxyphenyl)ethyl]amino}methyl)-2-methoxyphenol |