Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester
Modify Date: 2026-06-30 18:02:20
Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester structure
|
Common Name | Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 1791100-00-9 | Molecular Weight | 278.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H14N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H14N2O2 |
|---|---|
| Molecular Weight | 278.30 |
| InChIKey | ZGUYAPUZVXIQQG-UHFFFAOYSA-N |
| SMILES | O=C(NCc1ccnc2ccccc12)Oc1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester? |
| A: InChIKey of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester is ZGUYAPUZVXIQQG-UHFFFAOYSA-N. |
| Q: What is the CAS number of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester? |
| A: CAS number of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester is 1791100-00-9. |
| Q: What is the Chinese name of 1791100-00-9? |
| A: Chinese name of 1791100-00-9 is 1791100-00-9. |
| Q: What is the molecular formula of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester? |
| A: Molecular formula of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester is C17H14N2O2. |
| Q: What is the SMILES notation of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester? |
| A: SMILES notation of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester is O=C(NCc1ccnc2ccccc12)Oc1ccccc1. |
| Q: What is the English name of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester? |
| A: The English name of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester is Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester. |
| Q: What is the molecular weight of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester? |
| A: Molecular weight of Carbamic acid, N-(4-quinolinylmethyl)-, phenyl ester is 278.30. |