[10-(hydroxymethyl)-13-methyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate structure
|
Common Name | [10-(hydroxymethyl)-13-methyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate | ||
|---|---|---|---|---|
| CAS Number | 17916-14-2 | Molecular Weight | 348.47600 | |
| Density | 1.16g/cm3 | Boiling Point | 468ºC at 760 mmHg | |
| Molecular Formula | C21H32O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.1ºC | |
| Name | [10-(hydroxymethyl)-13-methyl-17-oxo-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-3-yl] acetate |
|---|
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 468ºC at 760 mmHg |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.47600 |
| Flash Point | 158.1ºC |
| Exact Mass | 348.23000 |
| PSA | 63.60000 |
| LogP | 3.50230 |
| Vapour Pressure | 9.99E-11mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | BMVMOKMILTUTPH-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC2(CO)C(CCC3C4CCC(=O)C4(C)CCC32)C1 |
|
~%
[10-(hydroxymet... CAS#:17916-14-2 |
| Literature: Dauben,W.G.; Ben-Efraim,D.A. Journal of Medicinal Chemistry, 1968 , vol. 11, p. 287 - 291 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |