(3S,10R,13S,14S,16R)-16-bromo-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol structure
|
Common Name | (3S,10R,13S,14S,16R)-16-bromo-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol | ||
|---|---|---|---|---|
| CAS Number | 17921-61-8 | Molecular Weight | 411.37300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H31BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3S,10R,13S,14S,16R)-16-bromo-10,13-dimethylspiro[1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-17,2'-1,3-dioxolane]-3-ol |
|---|
| Molecular Formula | C21H31BrO3 |
|---|---|
| Molecular Weight | 411.37300 |
| Exact Mass | 410.14600 |
| PSA | 38.69000 |
| LogP | 4.42660 |
| InChIKey | DKXAAPZYBUXMIL-WDDSKYLWSA-N |
| SMILES | CC12CCC(O)CC1=CCC1C2CCC2(C)C1CC(Br)C21OCCO1 |
|
~92%
(3S,10R,13S,14S... CAS#:17921-61-8 |
| Literature: Liu, Dashan; Stuhmiller, Louise M.; McMorris, Trevor C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2161 - 2168 |
|
~%
(3S,10R,13S,14S... CAS#:17921-61-8 |
| Literature: Liu, Dashan; Stuhmiller, Louise M.; McMorris, Trevor C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1988 , p. 2161 - 2168 |