1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol
Modify Date: 2026-07-16 17:30:06
1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol structure
|
Common Name | 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol | ||
|---|---|---|---|---|
| CAS Number | 1792995-90-4 | Molecular Weight | 245.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H9BrN2O2 |
|---|---|
| Molecular Weight | 245.07 |
| InChIKey | WRQSLKVCDINEJU-UHFFFAOYSA-N |
| SMILES | OC1CC(O)(c2ncc(Br)cn2)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol? |
| A: Molecular formula of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol is C8H9BrN2O2. |
| Q: What is the molecular weight of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol? |
| A: Molecular weight of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol is 245.07. |
| Q: What is the SMILES notation of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol? |
| A: SMILES notation of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol is OC1CC(O)(c2ncc(Br)cn2)C1. |
| Q: What is the InChIKey of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol? |
| A: InChIKey of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol is WRQSLKVCDINEJU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1792995-90-4? |
| A: Chinese name of 1792995-90-4 is 1792995-90-4. |
| Q: What is the CAS number of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol? |
| A: CAS number of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol is 1792995-90-4. |
| Q: What is the English name of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol? |
| A: The English name of 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol is 1-(5-bromo-2-pyrimidinyl)-1,3-Cyclobutanediol. |