2-Methoxyanofinic acid structure
|
Common Name | 2-Methoxyanofinic acid | ||
|---|---|---|---|---|
| CAS Number | 179457-70-6 | Molecular Weight | 234.25 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 376.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 143.4±21.4 °C | |
Use of 2-Methoxyanofinic acid2-Methoxyanofinic acid is an iridoid compound that can be found in Gentiana macrophylla[1]. |
| Name | 7-Methoxy-2,2-dimethyl-2H-chromene-6-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Methoxyanofinic acid is an iridoid compound that can be found in Gentiana macrophylla[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 376.8±42.0 °C at 760 mmHg |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 |
| Flash Point | 143.4±21.4 °C |
| Exact Mass | 234.089203 |
| LogP | 2.96 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | WVJWSWIKHOYGHH-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1C(=O)O)C=CC(C)(C)O2 |
| Storage condition | 2-8℃ |
| 2H-1-Benzopyran-6-carboxylic acid, 7-methoxy-2,2-dimethyl- |
| 7-Methoxy-2,2-dimethyl-2H-chromene-6-carboxylic acid |