Rutacridone structure
|
Common Name | Rutacridone | ||
|---|---|---|---|---|
| CAS Number | 17948-33-3 | Molecular Weight | 307.34 | |
| Density | 1.292g/cm3 | Boiling Point | 535ºC at 760mmHg | |
| Molecular Formula | C19H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.3ºC | |
Use of RutacridoneRutacridone is an alkaloid that can be cultured from Ruta graveolens L. strain R-19[1]. |
| Name | 5-hydroxy-11-methyl-2-prop-1-en-2-yl-1,2-dihydrofuro[2,3-c]acridin-6-one |
|---|---|
| Synonym | More Synonyms |
| Description | Rutacridone is an alkaloid that can be cultured from Ruta graveolens L. strain R-19[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.292g/cm3 |
|---|---|
| Boiling Point | 535ºC at 760mmHg |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.34 |
| Flash Point | 277.3ºC |
| Exact Mass | 307.12100 |
| PSA | 51.46000 |
| LogP | 3.27690 |
| Vapour Pressure | 4.64E-12mmHg at 25°C |
| Index of Refraction | 1.649 |
| InChIKey | FHAGACMCMQYSNX-UHFFFAOYSA-N |
| SMILES | C=C(C)C1Cc2c(cc(O)c3c(=O)c4ccccc4n(C)c23)O1 |
| (-)-Rutacridone |
| Rutacridon |
| Furo(2,3-c)acridin-6(2H)-one,1,11-dihydro-5-hydroxy-11-methyl-2-(1-methylethenyl)-,(-) |
| 5-hydroxy-2-isopropenyl-11-methyl-1,11-dihydro-2H-furo[2,3-c]acridin-6-one |