3-Methyl-2-oxovaleric acid-d8 sodium structure
|
Common Name | 3-Methyl-2-oxovaleric acid-d8 sodium | ||
|---|---|---|---|---|
| CAS Number | 1795037-03-4 | Molecular Weight | 160.17 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6HD8NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 3-Methyl-2-oxovaleric acid-d8 sodium3-Methyl-2-oxovaleric acid-d8 sodium is the deuterium labeled 3-Methyl-2-oxovaleric acid. 3-Methyl-2-oxovaleric acid is a neurotoxin, an acidogen, and a metabotoxin, and also an abnormal metabolite that arises from the incomplete breakdown of branched-chain amino acids[1]. |
| Name | 3-Methyl-2-oxovaleric acid-d8 sodium |
|---|
| Description | 3-Methyl-2-oxovaleric acid-d8 sodium is the deuterium labeled 3-Methyl-2-oxovaleric acid. 3-Methyl-2-oxovaleric acid is a neurotoxin, an acidogen, and a metabotoxin, and also an abnormal metabolite that arises from the incomplete breakdown of branched-chain amino acids[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C6HD8NaO3 |
|---|---|
| Molecular Weight | 160.17 |
| InChIKey | SMDJDLCNOXJGKC-FIRJCWQZSA-M |
| SMILES | CCC(C)C(=O)C(=O)[O-].[Na+] |