3-Dehydro Retinol Acetate-d3
Modify Date: 2025-11-01 17:14:56
3-Dehydro Retinol Acetate-d3 structure
|
Common Name | 3-Dehydro Retinol Acetate-d3 | ||
|---|---|---|---|---|
| CAS Number | 1795137-64-2 | Molecular Weight | 329.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H30O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Dehydro Retinol Acetate-d3 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H30O2 |
|---|---|
| Molecular Weight | 329.5 |
| InChIKey | FKPNTWPSTBQDNM-FKCFSCDSSA-N |
| SMILES | CC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)C=CCC1(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-Dehydro Retinol Acetate-d3? |
| A: InChIKey of 3-Dehydro Retinol Acetate-d3 is FKPNTWPSTBQDNM-FKCFSCDSSA-N. |
| Q: What is the CAS number of 3-Dehydro Retinol Acetate-d3? |
| A: CAS number of 3-Dehydro Retinol Acetate-d3 is 1795137-64-2. |
| Q: What is the molecular weight of 3-Dehydro Retinol Acetate-d3? |
| A: Molecular weight of 3-Dehydro Retinol Acetate-d3 is 329.5. |
| Q: What is the Chinese name of 1795137-64-2? |
| A: Chinese name of 1795137-64-2 is 1795137-64-2. |
| Q: What is the English name of 3-Dehydro Retinol Acetate-d3? |
| A: The English name of 3-Dehydro Retinol Acetate-d3 is 3-Dehydro Retinol Acetate-d3. |
| Q: What is the SMILES notation of 3-Dehydro Retinol Acetate-d3? |
| A: SMILES notation of 3-Dehydro Retinol Acetate-d3 is CC(=O)OCC=C(C)C=CC=C(C)C=CC1=C(C)C=CCC1(C)C. |
| Q: What is the molecular formula of 3-Dehydro Retinol Acetate-d3? |
| A: Molecular formula of 3-Dehydro Retinol Acetate-d3 is C22H30O2. |