3,5-diphenyl-1H-pyrazol-4-ol structure
|
Common Name | 3,5-diphenyl-1H-pyrazol-4-ol | ||
|---|---|---|---|---|
| CAS Number | 17953-06-9 | Molecular Weight | 236.26900 | |
| Density | 1.243g/cm3 | Boiling Point | 446ºC at 760 mmHg | |
| Molecular Formula | C15H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.5ºC | |
| Name | 3,5-diphenyl-1H-pyrazol-4-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.243g/cm3 |
|---|---|
| Boiling Point | 446ºC at 760 mmHg |
| Molecular Formula | C15H12N2O |
| Molecular Weight | 236.26900 |
| Flash Point | 223.5ºC |
| Exact Mass | 236.09500 |
| PSA | 48.91000 |
| LogP | 3.44930 |
| Vapour Pressure | 1.43E-08mmHg at 25°C |
| Index of Refraction | 1.656 |
| InChIKey | AWAVVFCXLWOCMD-UHFFFAOYSA-N |
| SMILES | Oc1c(-c2ccccc2)n[nH]c1-c1ccccc1 |
|
~72%
3,5-diphenyl-1H... CAS#:17953-06-9 |
| Literature: Bruno; Bondavalli; Ranise; Schenone; Losasso; C ilenti; Matera; Marmo Farmaco, 1990 , vol. 45, # 2 p. 147 - 166 |
|
~60%
3,5-diphenyl-1H... CAS#:17953-06-9 |
| Literature: Sangwan, Naresh K.; Verma, Braham S.; Dhindsa, Kuldip Singh Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1993 , vol. 32, # 4 p. 508 - 512 |
| 3,5-Diphenyl-4-hydroxy-pyrazol |
| 3,5-diphenyl-4-pyrazolol |
| 4-hydroxy-3,5-diphenylpyrazole |
| 4-Hydroxy-3,5-diphenyl-1H-pyrazole |