7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane
Modify Date: 2025-09-15 11:37:12
7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane structure
|
Common Name | 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane | ||
|---|---|---|---|---|
| CAS Number | 1795302-54-3 | Molecular Weight | 368.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H17ClN2O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H17ClN2O2S2 |
|---|---|
| Molecular Weight | 368.9 |
| InChIKey | FAPQWGIARFDFHB-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1cccnc1)N1CCSC(c2ccccc2Cl)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane? |
| A: SMILES notation of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane is O=S(=O)(c1cccnc1)N1CCSC(c2ccccc2Cl)CC1. |
| Q: What is the Chinese name of 1795302-54-3? |
| A: Chinese name of 1795302-54-3 is 1795302-54-3. |
| Q: What is the InChIKey of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane? |
| A: InChIKey of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane is FAPQWGIARFDFHB-UHFFFAOYSA-N. |
| Q: What is the English name of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane? |
| A: The English name of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane is 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane. |
| Q: What is the molecular weight of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane? |
| A: Molecular weight of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane is 368.9. |
| Q: What is the CAS number of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane? |
| A: CAS number of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane is 1795302-54-3. |
| Q: What is the molecular formula of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane? |
| A: Molecular formula of 7-(2-Chlorophenyl)-4-(pyridin-3-ylsulfonyl)-1,4-thiazepane is C16H17ClN2O2S2. |