N-phenyl-1H-indole-3-carboxamide
Modify Date: 2026-09-28 03:36:13
N-phenyl-1H-indole-3-carboxamide structure
|
Common Name | N-phenyl-1H-indole-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 17954-06-2 | Molecular Weight | 236.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-phenyl-1H-indole-3-carboxamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H12N2O |
|---|---|
| Molecular Weight | 236.27 |
| InChIKey | ARNKSDBIZXVFHP-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccccc1)c1c[nH]c2ccccc12 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of human N-terminal GST-tagged FLT3 cytoplasmic domain (564 to 993 residue...
Source: ChEMBL
Target: Receptor-type tyrosine-protein kinase FLT3
External Id: CHEMBL3794752
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 17954-06-2? |
| A: Chinese name of 17954-06-2 is 17954-06-2. |
| Q: What is the molecular formula of N-phenyl-1H-indole-3-carboxamide? |
| A: Molecular formula of N-phenyl-1H-indole-3-carboxamide is C15H12N2O. |
| Q: What is the molecular weight of N-phenyl-1H-indole-3-carboxamide? |
| A: Molecular weight of N-phenyl-1H-indole-3-carboxamide is 236.27. |
| Q: What is the CAS number of N-phenyl-1H-indole-3-carboxamide? |
| A: CAS number of N-phenyl-1H-indole-3-carboxamide is 17954-06-2. |
| Q: What is the InChIKey of N-phenyl-1H-indole-3-carboxamide? |
| A: InChIKey of N-phenyl-1H-indole-3-carboxamide is ARNKSDBIZXVFHP-UHFFFAOYSA-N. |
| Q: What is the English name of N-phenyl-1H-indole-3-carboxamide? |
| A: The English name of N-phenyl-1H-indole-3-carboxamide is N-phenyl-1H-indole-3-carboxamide. |
| Q: What is the SMILES notation of N-phenyl-1H-indole-3-carboxamide? |
| A: SMILES notation of N-phenyl-1H-indole-3-carboxamide is O=C(Nc1ccccc1)c1c[nH]c2ccccc12. |