1,1-Bis(triethylsilyl)propane structure
|
Common Name | 1,1-Bis(triethylsilyl)propane | ||
|---|---|---|---|---|
| CAS Number | 17955-47-4 | Molecular Weight | 272.61700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H36Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triethyl(1-triethylsilylpropyl)silane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H36Si2 |
|---|---|
| Molecular Weight | 272.61700 |
| Exact Mass | 272.23600 |
| LogP | 6.32280 |
| InChIKey | VWFCXQRCCLPCOU-UHFFFAOYSA-N |
| SMILES | CCC([Si](CC)(CC)CC)[Si](CC)(CC)CC |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,1-Bis-triethylsilyl-propan |
| Silane,propylidenebis*triethyl |