Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate
Modify Date: 2026-09-28 20:13:11
Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate structure
|
Common Name | Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 179554-91-7 | Molecular Weight | 266.29 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18N2O4 |
|---|---|
| Molecular Weight | 266.29 |
| InChIKey | JDFKHRFNTMYPEV-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CCc1cc(C)cc(N)n1)C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate? |
| A: InChIKey of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate is JDFKHRFNTMYPEV-UHFFFAOYSA-N. |
| Q: What is the English name of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate? |
| A: The English name of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate is Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate. |
| Q: What is the molecular weight of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate? |
| A: Molecular weight of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate is 266.29. |
| Q: What is the Chinese name of 179554-91-7? |
| A: Chinese name of 179554-91-7 is 179554-91-7. |
| Q: What is the CAS number of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate? |
| A: CAS number of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate is 179554-91-7. |
| Q: What is the molecular formula of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate? |
| A: Molecular formula of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate is C13H18N2O4. |
| Q: What is the SMILES notation of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate? |
| A: SMILES notation of Dimethyl (2-(6-amino-4-methyl-2-pyridinyl)ethyl)malonate is COC(=O)C(CCc1cc(C)cc(N)n1)C(=O)OC. |