Ethyl 5-(methylsulfonamido)-1H-indole-2-carboxylate
Ethyl 5-(methylsulfonamido)-1H-indole-2-carboxylate structure
|
Common Name | Ethyl 5-(methylsulfonamido)-1H-indole-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 179556-14-0 | Molecular Weight | 282.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 5-methanesulfonamidoindole-2-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14N2O4S |
|---|---|
| Molecular Weight | 282.31600 |
| Exact Mass | 282.06700 |
| PSA | 96.64000 |
| LogP | 2.86990 |
| InChIKey | JIKNCQOTMSZCCM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc2cc(NS(C)(=O)=O)ccc2[nH]1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of MMP13 at 500 uM after 30 mins by fluorimetry in the presence of 1.25% h...
Source: ChEMBL
Target: Collagenase 3
External Id: CHEMBL1942127
|
|
Name: Inhibition of human recombinant MMP2 after 30 mins by fluorimetry
Source: ChEMBL
Target: 72 kDa type IV collagenase
External Id: CHEMBL1942129
|
|
Name: Inhibition of human MMP13 expressed in Escherichia coli after 30 mins by fluorimetry
Source: ChEMBL
Target: Collagenase 3
External Id: CHEMBL1942128
|
|
Name: Inhibition of human recombinant MMP14 after 60 mins by fluorimetry
Source: ChEMBL
Target: Matrix metalloproteinase-14
External Id: CHEMBL1942130
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: InChIKey of ethyl 5-methanesulfonamidoindole-2-carboxylate is JIKNCQOTMSZCCM-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: Polar surface area (PSA) of ethyl 5-methanesulfonamidoindole-2-carboxylate is 96.64000. |
| Q: What is the LogP of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: LogP of ethyl 5-methanesulfonamidoindole-2-carboxylate is 2.86990. |
| Q: What is the SMILES notation of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: SMILES notation of ethyl 5-methanesulfonamidoindole-2-carboxylate is CCOC(=O)c1cc2cc(NS(C)(=O)=O)ccc2[nH]1. |
| Q: What is the CAS number of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: CAS number of ethyl 5-methanesulfonamidoindole-2-carboxylate is 179556-14-0. |
| Q: What is the molecular weight of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: Molecular weight of ethyl 5-methanesulfonamidoindole-2-carboxylate is 282.31600. |
| Q: What is the English name of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: The English name of ethyl 5-methanesulfonamidoindole-2-carboxylate is ethyl 5-methanesulfonamidoindole-2-carboxylate. |
| Q: What is the molecular formula of ethyl 5-methanesulfonamidoindole-2-carboxylate? |
| A: Molecular formula of ethyl 5-methanesulfonamidoindole-2-carboxylate is C12H14N2O4S. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |