4-Piperidinamine,n-(3-ethoxy-2-pyridinyl)-n-methyl-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]
Modify Date: 2026-03-27 14:10:14
![4-Piperidinamine,n-(3-ethoxy-2-pyridinyl)-n-methyl-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] Structure](https://www.chemsrc.com/extcaspic/163/179556-81-1.png)
4-Piperidinamine,n-(3-ethoxy-2-pyridinyl)-n-methyl-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] structure
|
Common Name | 4-Piperidinamine,n-(3-ethoxy-2-pyridinyl)-n-methyl-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] | ||
|---|---|---|---|---|
| CAS Number | 179556-81-1 | Molecular Weight | 471.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H29N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Piperidinamine,n-(3-ethoxy-2-pyridinyl)-n-methyl-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] |
|---|
| Molecular Formula | C23H29N5O4S |
|---|---|
| Molecular Weight | 471.6 |
| InChIKey | OCVDGPQJSORGJV-UHFFFAOYSA-N |
| SMILES | CCOC1=C(N=CC=C1)N(C)C2CCN(CC2)C(=O)C3=CC4=C(N3)C=CC(=C4)NS(=O)(=O)C |
|
Name: Concentration required to inhibit Y181C type RNA dependent DNA polymerase.
Source: ChEMBL
Target: Nucleic Acid
External Id: CHEMBL768319
|
|
Name: Concentration required to inhibit wild type RNA dependent DNA polymerase.
Source: ChEMBL
Target: Nucleic Acid
External Id: CHEMBL768320
|
|
Name: In vitro inhibition of HIV-1 D34 replication in human peripheral blood mononuclear ce...
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL763516
|
|
Name: In vitro inhibition of HIV-1 reverse transcriptase at 100 uM.
Source: ChEMBL
Target: Reverse transcriptase/RNaseH
External Id: CHEMBL800644
|
|
Name: Concentration required to inhibit P236L type RNA dependent DNA polymerase.
Source: ChEMBL
Target: Nucleic Acid
External Id: CHEMBL768318
|
|
Name: Fold resistance expressed as ratio of IC 50 mutant Y181C vs WT RT
Source: ChEMBL
Target: N/A
External Id: CHEMBL844096
|
|
Name: Fold resistance expressed as ratio of IC 50 mutant P236L vs WT RT
Source: ChEMBL
Target: N/A
External Id: CHEMBL844095
|
|
Name: In vitro for inhibition of HIV-1 reverse transcriptase.
Source: ChEMBL
Target: Reverse transcriptase/RNaseH
External Id: CHEMBL797533
|
Total 11, Current Page 1 of 2
1
2