4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] structure
|
Common Name | 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] | ||
|---|---|---|---|---|
| CAS Number | 179556-87-7 | Molecular Weight | 485.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H31N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C24H31N5O4S |
|---|---|
| Molecular Weight | 485.6 |
| InChIKey | GOVNLCZMXFXJSM-UHFFFAOYSA-N |
| SMILES | CC(C)OC1=C(N=CC=C1)N(C)C2CCN(CC2)C(=O)C3=CC4=C(N3)C=CC(=C4)NS(=O)(=O)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: In vitro inhibition of HIV-1 reverse transcriptase at 100 uM.
Source: ChEMBL
Target: Reverse transcriptase/RNaseH
External Id: CHEMBL800644
|
|
Name: Effective dose ofcompound against replication of HIV-1 D34 isolate in human PBMC was ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL763518
|
|
Name: Fold resistance expressed as ratio of IC 50 mutant Y181C vs WT RT
Source: ChEMBL
Target: N/A
External Id: CHEMBL844096
|
|
Name: Fold resistance expressed as ratio of IC 50 mutant P236L vs WT RT
Source: ChEMBL
Target: N/A
External Id: CHEMBL844095
|
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]? |
| A: Molecular formula of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] is C24H31N5O4S. |
| Q: What is the English name of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]? |
| A: The English name of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] is 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]. |
| Q: What is the InChIKey of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]? |
| A: InChIKey of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] is GOVNLCZMXFXJSM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]? |
| A: SMILES notation of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] is CC(C)OC1=C(N=CC=C1)N(C)C2CCN(CC2)C(=O)C3=CC4=C(N3)C=CC(=C4)NS(=O)(=O)C. |
| Q: What is the Chinese name of 179556-87-7? |
| A: Chinese name of 179556-87-7 is 179556-87-7. |
| Q: What is the molecular weight of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]? |
| A: Molecular weight of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] is 485.6. |
| Q: What is the CAS number of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl]? |
| A: CAS number of 4-Piperidinamine,n-methyl-n-[3-(1-methylethoxy)-2-pyridinyl]-1-[[5-[(methylsulfonyl)amino]-1h-indol-2-yl]carbonyl] is 179556-87-7. |