tert-butyl 4-(isobutylamino)piperidine-1-carboxylate
Modify Date: 2025-08-25 17:56:26
tert-butyl 4-(isobutylamino)piperidine-1-carboxylate structure
|
Common Name | tert-butyl 4-(isobutylamino)piperidine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 179556-97-9 | Molecular Weight | 256.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H28N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 4-(isobutylamino)piperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H28N2O2 |
|---|---|
| Molecular Weight | 256.38400 |
| Exact Mass | 256.21500 |
| PSA | 41.57000 |
| LogP | 2.96030 |
| InChIKey | XTHUDKQRZVVDNY-UHFFFAOYSA-N |
| SMILES | CC(C)CNC1CCN(C(=O)OC(C)(C)C)CC1 |
| HS Code | 2933399090 |
|---|
|
~99%
tert-butyl 4-(i... CAS#:179556-97-9 |
| Literature: ELI LILLY AND COMPANY Patent: WO2004/52858 A2, 2004 ; Location in patent: Page 47 ; WO 2004/052858 A2 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,1-dimethylethyl 4-[(2-methylpropyl)amino]piperidine-1-carboxylate |
| Benzoic acid,4-[(2-methylpropyl)amino]-,ethyl ester |
| 1-(1,1-dimethylethoxycarbonyl)-4-(2-methylpropylamino)piperidine |
| 4-isobutylamino-benzoic acid ethyl ester |
| 4-Isobutylamino-benzoesaeure-aethylester |
| tert-butyl 4-(2-methylpropylamino)piperidine-1-carboxylate |
| 4-isobutylamino-piperidine-1-carboxylic acid tert-butyl ester |