1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea
Modify Date: 2025-11-06 19:31:15
![1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea Structure](https://www.chemsrc.com/extcaspic/346/1796237-85-8.png)
1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea structure
|
Common Name | 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea | ||
|---|---|---|---|---|
| CAS Number | 1796237-85-8 | Molecular Weight | 347.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H33N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H33N3O2 |
|---|---|
| Molecular Weight | 347.5 |
| InChIKey | KVQWQFFNNPTVBZ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)NC1CCN(C(=O)CC23CC4CC(CC(C4)C2)C3)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea? |
| A: The English name of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea is 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea. |
| Q: What is the molecular weight of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea? |
| A: Molecular weight of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea is 347.5. |
| Q: What is the CAS number of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea? |
| A: CAS number of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea is 1796237-85-8. |
| Q: What is the InChIKey of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea? |
| A: InChIKey of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea is KVQWQFFNNPTVBZ-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea? |
| A: Molecular formula of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea is C20H33N3O2. |
| Q: What is the Chinese name of 1796237-85-8? |
| A: Chinese name of 1796237-85-8 is 1796237-85-8. |
| Q: What is the SMILES notation of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea? |
| A: SMILES notation of 1-{1-[2-(Adamantan-1-YL)acetyl]piperidin-4-YL}-3,3-dimethylurea is CN(C)C(=O)NC1CCN(C(=O)CC23CC4CC(CC(C4)C2)C3)CC1. |