4-[(4-chlorophenyl)-ethoxyphosphinothioyl]oxybenzonitrile structure
|
Common Name | 4-[(4-chlorophenyl)-ethoxyphosphinothioyl]oxybenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 17963-68-7 | Molecular Weight | 337.76100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13ClNO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(4-chlorophenyl)-ethoxyphosphinothioyl]oxybenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H13ClNO2PS |
|---|---|
| Molecular Weight | 337.76100 |
| Exact Mass | 337.00900 |
| PSA | 84.15000 |
| LogP | 4.91258 |
| Vapour Pressure | 4E-08mmHg at 25°C |
| InChIKey | GCUAAPLYOJTVGX-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(Oc1ccc(C#N)cc1)c1ccc(Cl)cc1 |
| O-(4-cyanophenyl) O-ethyl (4-chlorophenyl)phosphonothioate |
| (p-Chlorophenyl)phosphonothioic acid O-ethyl ester O-ester with p-hydroxybenzonitrile |
| Phosphonothioic acid,(p-chlorophenyl)-,O-ethyl ester,O-ester with p-hydroxybenzonitrile |