4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine
Modify Date: 2026-07-01 21:34:52
![4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine Structure](https://www.chemsrc.com/extcaspic/094/1796562-79-2.png)
4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine structure
|
Common Name | 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1796562-79-2 | Molecular Weight | 291.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H22ClN3 |
|---|---|
| Molecular Weight | 291.82 |
| InChIKey | KGBZUXXNUFWQAZ-UHFFFAOYSA-N |
| SMILES | Cc1nc(Cl)c2cc(CCN3CCCCC3)[nH]c2c1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine? |
| A: Molecular weight of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine is 291.82. |
| Q: What is the CAS number of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine? |
| A: CAS number of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine is 1796562-79-2. |
| Q: What is the SMILES notation of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine? |
| A: SMILES notation of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine is Cc1nc(Cl)c2cc(CCN3CCCCC3)[nH]c2c1C. |
| Q: What is the InChIKey of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine? |
| A: InChIKey of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine is KGBZUXXNUFWQAZ-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine? |
| A: The English name of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine is 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine. |
| Q: What is the molecular formula of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine? |
| A: Molecular formula of 4-Chloro-6,7-dimethyl-2-[2-(1-piperidinyl)ethyl]-1H-pyrrolo[3,2-c]pyridine is C16H22ClN3. |
| Q: What is the Chinese name of 1796562-79-2? |
| A: Chinese name of 1796562-79-2 is 1796562-79-2. |