BZ-ORN-OH structure
|
Common Name | BZ-ORN-OH | ||
|---|---|---|---|---|
| CAS Number | 17966-71-1 | Molecular Weight | 236.267 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 514.3±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 264.9±28.7 °C | |
| Name | (2S)-5-amino-2-benzamidopentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 514.3±45.0 °C at 760 mmHg |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.267 |
| Flash Point | 264.9±28.7 °C |
| Exact Mass | 236.116089 |
| PSA | 92.42000 |
| LogP | 0.15 |
| Appearance of Characters | Powder | Off-white to white |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | PKONOCQSEOHHJW-JTQLQIEISA-N |
| SMILES | NCCCC(NC(=O)c1ccccc1)C(=O)O |
| Storage condition | Store at RT. |
| HS Code | 2924299090 |
|---|
|
~%
BZ-ORN-OH CAS#:17966-71-1 |
| Literature: Goldschmidt; Fuener Justus Liebigs Annalen der Chemie, 1930 , vol. 483, p. 190,195, 201, 207, 211, 213 |
|
~%
BZ-ORN-OH CAS#:17966-71-1 |
| Literature: Goldschmidt; Fuener Justus Liebigs Annalen der Chemie, 1930 , vol. 483, p. 190,195, 201, 207, 211, 213 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Benzoyl-L-ornithine |
| N2-Benzoyl-ornithin |
| N-Benzoyl-Ornithine |
| L-Ornithine, N-benzoyl- |
| N2-Benzoyl-L-ornithine |
| BZ-ORN-OH |