Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy)
Modify Date: 2026-07-20 17:35:58
![Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) Structure](https://www.chemsrc.com/extcaspic/385/1796880-00-6.png)
Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) structure
|
Common Name | Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) | ||
|---|---|---|---|---|
| CAS Number | 1796880-00-6 | Molecular Weight | 343.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H26FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H26FNO2 |
|---|---|
| Molecular Weight | 343.4 |
| InChIKey | WADLXGOPQXPMRQ-UHFFFAOYSA-N |
| SMILES | CC(C)COc1ccc(C(=O)NCC(C)(C)c2ccccc2F)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy)? |
| A: The English name of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) is Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy). |
| Q: What is the CAS number of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy)? |
| A: CAS number of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) is 1796880-00-6. |
| Q: What is the molecular formula of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy)? |
| A: Molecular formula of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) is C21H26FNO2. |
| Q: What is the Chinese name of 1796880-00-6? |
| A: Chinese name of 1796880-00-6 is 1796880-00-6. |
| Q: What is the SMILES notation of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy)? |
| A: SMILES notation of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) is CC(C)COc1ccc(C(=O)NCC(C)(C)c2ccccc2F)cc1. |
| Q: What is the molecular weight of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy)? |
| A: Molecular weight of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) is 343.4. |
| Q: What is the InChIKey of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy)? |
| A: InChIKey of Benzamide, N-[2-(2-fluorophenyl)-2-methylpropyl]-4-(2-methylpropoxy) is WADLXGOPQXPMRQ-UHFFFAOYSA-N. |