2-(p-Chlorophenyl)-4-methyl-5-thiazoleacetic acid structure
|
Common Name | 2-(p-Chlorophenyl)-4-methyl-5-thiazoleacetic acid | ||
|---|---|---|---|---|
| CAS Number | 17969-41-4 | Molecular Weight | 267.73100 | |
| Density | 1.386g/cm3 | Boiling Point | 456.6ºC at 760 mmHg | |
| Molecular Formula | C12H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230ºC | |
| Name | 2-[2-(4-chlorophenyl)-4-methyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.386g/cm3 |
|---|---|
| Boiling Point | 456.6ºC at 760 mmHg |
| Molecular Formula | C12H10ClNO2S |
| Molecular Weight | 267.73100 |
| Flash Point | 230ºC |
| Exact Mass | 267.01200 |
| PSA | 78.43000 |
| LogP | 3.39900 |
| Vapour Pressure | 3.94E-09mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | PQLZUIFGDGNALU-UHFFFAOYSA-N |
| SMILES | Cc1nc(-c2ccc(Cl)cc2)sc1CC(=O)O |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Acide p-chlorophenyl-2 methyl-4-thiazole-acetique-5 |
| 2-(p-Chlorphenyl)-4-methyl-5-carboxymethylthiazol |
| 5-THIAZOLEACETIC ACID,2-(p-CHLOROPHENYL)-4-METHYL |
| 2-(p-Chlorophenyl)-4-methyl-5-thiazoleacetic acid |
| [2-(4-chloro-phenyl)-4-methyl-thiazol-5-yl]-acetic acid |
| Acide p-chlorophenyl-2 methyl-4-thiazole-acetique-5 [French] |
| 2-[2-(4-chlorophenyl)-4-methylthiazol-5-yl]acetic acid |