2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid
Modify Date: 2025-08-25 18:04:49
![2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid Structure](https://image.chemsrc.com/caspic/063/17969-45-8.png)
2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid structure
|
Common Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 17969-45-8 | Molecular Weight | 312.18200 | |
| Density | 1.518g/cm3 | Boiling Point | 472.7ºC at 760mmHg | |
| Molecular Formula | C12H10BrNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
| Name | 2-[4-(4-bromophenyl)-1,3-thiazol-2-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.518g/cm3 |
|---|---|
| Boiling Point | 472.7ºC at 760mmHg |
| Molecular Formula | C12H10BrNO2S |
| Molecular Weight | 312.18200 |
| Flash Point | 239.7ºC |
| Exact Mass | 310.96200 |
| PSA | 78.43000 |
| LogP | 3.76070 |
| Index of Refraction | 1.619 |
| InChIKey | JGQKYWPSFPCKLW-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)c1nc(-c2ccc(Br)cc2)cs1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Brofezil |
| Brofezilo |
| Brofezilum |
| UNII-E375EMI4HW |
| (RS)-2-(4-(4-Bromophenyl)-2-thiazolul)propionsaeure |
| 2-[4-(4-bromo-phenyl)-thiazol-2-yl]-propionic acid |