2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-2-methyl-propanoic acid structure
|
Common Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-2-methyl-propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 17969-68-5 | Molecular Weight | 281.75800 | |
| Density | 1.337g/cm3 | Boiling Point | 443.8ºC at 760 mmHg | |
| Molecular Formula | C13H12ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.2ºC | |
| Name | 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]-2-methylpropanoic acid |
|---|
| Density | 1.337g/cm3 |
|---|---|
| Boiling Point | 443.8ºC at 760 mmHg |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.75800 |
| Flash Point | 222.2ºC |
| Exact Mass | 281.02800 |
| PSA | 78.43000 |
| LogP | 3.82570 |
| Vapour Pressure | 1.18E-08mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | JSZXNOZBITZAKG-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)c1csc(-c2ccc(Cl)cc2)n1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |