3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one structure
|
Common Name | 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one | ||
|---|---|---|---|---|
| CAS Number | 1797435-81-4 | Molecular Weight | 216.24 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H12N4O |
|---|---|
| Molecular Weight | 216.24 |
| InChIKey | OLLGPONQUNRWBS-UHFFFAOYSA-N |
| SMILES | CNc1ccc(-n2cccc(N)c2=O)cn1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one? |
| A: Molecular formula of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one is C11H12N4O. |
| Q: What is the SMILES notation of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one? |
| A: SMILES notation of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one is CNc1ccc(-n2cccc(N)c2=O)cn1. |
| Q: What is the molecular weight of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one? |
| A: Molecular weight of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one is 216.24. |
| Q: What is the Chinese name of 1797435-81-4? |
| A: Chinese name of 1797435-81-4 is 1797435-81-4. |
| Q: What is the CAS number of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one? |
| A: CAS number of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one is 1797435-81-4. |
| Q: What is the English name of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one? |
| A: The English name of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one is 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one. |
| Q: What is the InChIKey of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one? |
| A: InChIKey of 3-Amino-6'-(methylamino)[1(2H),3'-bipyridin]-2-one is OLLGPONQUNRWBS-UHFFFAOYSA-N. |