(R)-3-N-CBZ-AMINO-SUCCINIMIDE structure
|
Common Name | (R)-3-N-CBZ-AMINO-SUCCINIMIDE | ||
|---|---|---|---|---|
| CAS Number | 179747-84-3 | Molecular Weight | 248.23500 | |
| Density | 1.35g/cm3 | Boiling Point | 515.1ºC at 760mmHg | |
| Molecular Formula | C12H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.3ºC | |
| Name | benzyl N-[(3R)-2,5-dioxopyrrolidin-3-yl]carbamate |
|---|
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 515.1ºC at 760mmHg |
| Molecular Formula | C12H12N2O4 |
| Molecular Weight | 248.23500 |
| Flash Point | 265.3ºC |
| Exact Mass | 248.08000 |
| PSA | 84.50000 |
| LogP | 1.04760 |
| Vapour Pressure | 1.02E-10mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | QRQMHYISDDHZBY-SECBINFHSA-N |
| SMILES | O=C1CC(NC(=O)OCc2ccccc2)C(=O)N1 |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |