2-Propenoic acid,2,2-dinitropropyl ester structure
|
Common Name | 2-Propenoic acid,2,2-dinitropropyl ester | ||
|---|---|---|---|---|
| CAS Number | 17977-09-2 | Molecular Weight | 204.13800 | |
| Density | 1.345g/cm3 | Boiling Point | 306.6ºC at 760mmHg | |
| Molecular Formula | C6H8N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 146ºC | |
| Name | 2,2-dinitropropyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.345g/cm3 |
|---|---|
| Boiling Point | 306.6ºC at 760mmHg |
| Molecular Formula | C6H8N2O6 |
| Molecular Weight | 204.13800 |
| Flash Point | 146ºC |
| Exact Mass | 204.03800 |
| PSA | 117.94000 |
| LogP | 1.03160 |
| Vapour Pressure | 0.000765mmHg at 25°C |
| Index of Refraction | 1.483 |
| InChIKey | BGPPMVLBKMPVQR-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(C)([N+](=O)[O-])[N+](=O)[O-] |
|
~%
2-Propenoic aci... CAS#:17977-09-2 |
| Literature: Journal of Organic Chemistry, , vol. 26, p. 4729 - 4731 US2967195 , ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 241-897-0 |
| 2,2-Dinitropropyl 2-propenoate |
| 2,2-Dinitropropylacrylat |
| 2,2-DINITROPROPYL ACRYLATE |
| 1-Acryloyloxy-2,2-dinitro-propan |
| Acrylic acid,2-dinitropropyl ester |