N-demethyl Pazopanib (Positional Isomer)
Modify Date: 2026-08-19 17:48:56
N-demethyl Pazopanib (Positional Isomer) structure
|
Common Name | N-demethyl Pazopanib (Positional Isomer) | ||
|---|---|---|---|---|
| CAS Number | 1797832-43-9 | Molecular Weight | 423.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H21N7O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-demethyl Pazopanib (Positional Isomer) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C20H21N7O2S |
|---|---|
| Molecular Weight | 423.5 |
| InChIKey | KXEITTOLAUJQPU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Nc2ccnc(Nc3ccc4c(C)n(C)nc4c3)n2)cc1S(N)(=O)=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of N-demethyl Pazopanib (Positional Isomer)? |
| A: InChIKey of N-demethyl Pazopanib (Positional Isomer) is KXEITTOLAUJQPU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-demethyl Pazopanib (Positional Isomer)? |
| A: SMILES notation of N-demethyl Pazopanib (Positional Isomer) is Cc1ccc(Nc2ccnc(Nc3ccc4c(C)n(C)nc4c3)n2)cc1S(N)(=O)=O. |
| Q: What is the molecular weight of N-demethyl Pazopanib (Positional Isomer)? |
| A: Molecular weight of N-demethyl Pazopanib (Positional Isomer) is 423.5. |
| Q: What is the English name of N-demethyl Pazopanib (Positional Isomer)? |
| A: The English name of N-demethyl Pazopanib (Positional Isomer) is N-demethyl Pazopanib (Positional Isomer). |
| Q: What is the Chinese name of 1797832-43-9? |
| A: Chinese name of 1797832-43-9 is 1797832-43-9. |
| Q: What is the CAS number of N-demethyl Pazopanib (Positional Isomer)? |
| A: CAS number of N-demethyl Pazopanib (Positional Isomer) is 1797832-43-9. |
| Q: What is the molecular formula of N-demethyl Pazopanib (Positional Isomer)? |
| A: Molecular formula of N-demethyl Pazopanib (Positional Isomer) is C20H21N7O2S. |