5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid structure
|
Common Name | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1797983-23-3 | Molecular Weight | 288.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N2O5 | Melting Point | >180°C (dec.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-amino-2-carboxyphenyl)amino]-2-hydroxybenzoic acid |
|---|
| Melting Point | >180°C (dec.) |
|---|---|
| Molecular Formula | C14H12N2O5 |
| Molecular Weight | 288.26 |
| Appearance of Characters | Solid | Yellow to Dark Green |
| InChIKey | FNKYNYBONZATNB-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Nc2ccc(O)c(C(=O)O)c2)c(C(=O)O)c1 |
| Storage condition | Hygroscopic, Refrigerator, Under Inert Atmosphere |
| Stability | Hygroscopic |
| Water Solubility | DMSO (Slightly), Methanol (Slightly) |