Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl
Modify Date: 2026-07-26 20:24:28
Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl structure
|
Common Name | Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl | ||
|---|---|---|---|---|
| CAS Number | 1798140-00-7 | Molecular Weight | 281.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H23NO4 |
|---|---|
| Molecular Weight | 281.35 |
| InChIKey | MEAHICWWMVMMLD-UHFFFAOYSA-N |
| SMILES | CCCCN(C)C(=O)c1c(OC)cc(OC)cc1OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl? |
| A: The English name of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl is Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl. |
| Q: What is the Chinese name of 1798140-00-7? |
| A: Chinese name of 1798140-00-7 is 1798140-00-7. |
| Q: What is the CAS number of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl? |
| A: CAS number of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl is 1798140-00-7. |
| Q: What is the molecular formula of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl? |
| A: Molecular formula of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl is C15H23NO4. |
| Q: What is the SMILES notation of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl? |
| A: SMILES notation of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl is CCCCN(C)C(=O)c1c(OC)cc(OC)cc1OC. |
| Q: What is the molecular weight of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl? |
| A: Molecular weight of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl is 281.35. |
| Q: What is the InChIKey of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl? |
| A: InChIKey of Benzamide, N-butyl-2,4,6-trimethoxy-N-methyl is MEAHICWWMVMMLD-UHFFFAOYSA-N. |