ethyl N-[4-fluoro-3-(trifluoromethyl)phenyl]carbamate structure
|
Common Name | ethyl N-[4-fluoro-3-(trifluoromethyl)phenyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1799-83-3 | Molecular Weight | 251.17800 | |
| Density | 1.371g/cm3 | Boiling Point | 220.6ºC at 760 mmHg | |
| Molecular Formula | C10H9F4NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 87.2ºC | |
| Name | ethyl (4-fluoro-3-(trifluoromethyl)phenyl)carbamate |
|---|
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 220.6ºC at 760 mmHg |
| Molecular Formula | C10H9F4NO2 |
| Molecular Weight | 251.17800 |
| Flash Point | 87.2ºC |
| Exact Mass | 251.05700 |
| PSA | 38.33000 |
| LogP | 3.48590 |
| Vapour Pressure | 0.112mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | KMDMOOQOWPAFMR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Nc1ccc(F)c(C(F)(F)F)c1 |
|
~%
ethyl N-[4-fluo... CAS#:1799-83-3 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
|
~%
ethyl N-[4-fluo... CAS#:1799-83-3 |
| Literature: Finger,G.C. et al. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 572 - 573 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |