2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol
Modify Date: 2025-09-09 17:56:30
2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol structure
|
Common Name | 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 1799530-80-5 | Molecular Weight | 276.08 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H5BrF3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H5BrF3NOS |
|---|---|
| Molecular Weight | 276.08 |
| InChIKey | AMCFZCPFIMPTKZ-UHFFFAOYSA-N |
| SMILES | CC(O)(c1ncc(Br)s1)C(F)(F)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol? |
| A: Molecular weight of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol is 276.08. |
| Q: What is the Chinese name of 1799530-80-5? |
| A: Chinese name of 1799530-80-5 is 1799530-80-5. |
| Q: What is the molecular formula of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol? |
| A: Molecular formula of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol is C6H5BrF3NOS. |
| Q: What is the English name of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol? |
| A: The English name of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol is 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol. |
| Q: What is the CAS number of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol? |
| A: CAS number of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol is 1799530-80-5. |
| Q: What is the SMILES notation of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol? |
| A: SMILES notation of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol is CC(O)(c1ncc(Br)s1)C(F)(F)F. |
| Q: What is the InChIKey of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol? |
| A: InChIKey of 2-(5-Bromothiazol-2-yl)-1,1,1-trifluoropropan-2-ol is AMCFZCPFIMPTKZ-UHFFFAOYSA-N. |