Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate
Modify Date: 2026-07-13 14:20:37
Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate structure
|
Common Name | Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1799544-61-8 | Molecular Weight | 330.8 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H15ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H15ClN2O3 |
|---|---|
| Molecular Weight | 330.8 |
| InChIKey | MDHFRXNWWVVPJY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1Cc2ncc(Cl)cc2N(Cc2ccccc2)C1=O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate? |
| A: The English name of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate is Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate. |
| Q: What is the SMILES notation of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate? |
| A: SMILES notation of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate is COC(=O)C1Cc2ncc(Cl)cc2N(Cc2ccccc2)C1=O. |
| Q: What is the CAS number of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate? |
| A: CAS number of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate is 1799544-61-8. |
| Q: What is the molecular weight of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate? |
| A: Molecular weight of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate is 330.8. |
| Q: What is the InChIKey of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate? |
| A: InChIKey of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate is MDHFRXNWWVVPJY-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate? |
| A: Molecular formula of Methyl 1-benzyl-7-chloro-2-oxo-1,2,3,4-tetrahydro-1,5-naphthyridine-3-carboxylate is C17H15ClN2O3. |
| Q: What is the Chinese name of 1799544-61-8? |
| A: Chinese name of 1799544-61-8 is 1799544-61-8. |