6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one
Modify Date: 2026-07-27 11:43:20
![6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one Structure](https://www.chemsrc.com/extcaspic/208/1799610-94-8.png)
6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one structure
|
Common Name | 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 1799610-94-8 | Molecular Weight | 356.97 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H2BrIN2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H2BrIN2OS |
|---|---|
| Molecular Weight | 356.97 |
| InChIKey | SIDVXCNUWRDKCE-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cnc2sc(Br)c(I)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one? |
| A: The English name of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one is 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one. |
| Q: What is the Chinese name of 1799610-94-8? |
| A: Chinese name of 1799610-94-8 is 1799610-94-8. |
| Q: What is the molecular formula of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one? |
| A: Molecular formula of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one is C6H2BrIN2OS. |
| Q: What is the SMILES notation of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one? |
| A: SMILES notation of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one is O=c1[nH]cnc2sc(Br)c(I)c12. |
| Q: What is the InChIKey of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one? |
| A: InChIKey of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one is SIDVXCNUWRDKCE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one? |
| A: CAS number of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one is 1799610-94-8. |
| Q: What is the molecular weight of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one? |
| A: Molecular weight of 6-Bromo-5-iodothieno[2,3-d]pyrimidin-4(1H)-one is 356.97. |