benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate
Modify Date: 2026-08-21 15:32:53
![benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate Structure](https://www.chemsrc.com/extcaspic/016/1799661-66-7.png)
benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate structure
|
Common Name | benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 1799661-66-7 | Molecular Weight | 245.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H19NO2 |
|---|---|
| Molecular Weight | 245.32 |
| InChIKey | AZZITAUSJPVTCH-CYBMUJFWSA-N |
| SMILES | C#CC(NC(=O)OCc1ccccc1)C(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate? |
| A: Molecular formula of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate is C15H19NO2. |
| Q: What is the English name of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate? |
| A: The English name of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate is benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate. |
| Q: What is the InChIKey of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate? |
| A: InChIKey of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate is AZZITAUSJPVTCH-CYBMUJFWSA-N. |
| Q: What is the SMILES notation of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate? |
| A: SMILES notation of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate is C#CC(NC(=O)OCc1ccccc1)C(C)(C)C. |
| Q: What is the CAS number of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate? |
| A: CAS number of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate is 1799661-66-7. |
| Q: What is the molecular weight of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate? |
| A: Molecular weight of benzyl N-[(3S)-4,4-dimethylpent-1-yn-3-yl]carbamate is 245.32. |
| Q: What is the Chinese name of 1799661-66-7? |
| A: Chinese name of 1799661-66-7 is 1799661-66-7. |