[S,(+)]-5-[(Z)-Ethylidene]-2-hydroxy-2-methyl-3-methylenehexanedioic acid structure
|
Common Name | [S,(+)]-5-[(Z)-Ethylidene]-2-hydroxy-2-methyl-3-methylenehexanedioic acid | ||
|---|---|---|---|---|
| CAS Number | 18003-06-0 | Molecular Weight | 214.21500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H14O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R,5Z)-5-ethylidene-2-hydroxy-2-methyl-3-methylidenehexanedioic acid |
|---|
| Molecular Formula | C10H14O5 |
|---|---|
| Molecular Weight | 214.21500 |
| Exact Mass | 214.08400 |
| PSA | 94.83000 |
| LogP | 0.79920 |
| Vapour Pressure | 2.83E-11mmHg at 25°C |
| InChIKey | AKOXKNVOTFFDSM-ISGFRBBESA-N |
| SMILES | C=C(CC(=CC)C(=O)O)C(C)(O)C(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |