Minodronic acid structure
|
Common Name | Minodronic acid | ||
|---|---|---|---|---|
| CAS Number | 180064-38-4 | Molecular Weight | 322.14800 | |
| Density | 1.973 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H12N2O7P2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Minodronic acidMinodronic acid (YM-529) is a third-generation bisphosphonate that directly and indirectly prevents proliferation, induces apoptosis, and inhibits metastasis of various types of cancer cells. Minodronic acid (YM-529) is an antagonist of purinergic P2X2/3 receptors involved in pain[1][2]. |
| Name | Minodronic acid |
|---|
| Description | Minodronic acid (YM-529) is a third-generation bisphosphonate that directly and indirectly prevents proliferation, induces apoptosis, and inhibits metastasis of various types of cancer cells. Minodronic acid (YM-529) is an antagonist of purinergic P2X2/3 receptors involved in pain[1][2]. |
|---|---|
| Related Catalog | |
| Target |
P2X2/3[2] |
| References |
| Density | 1.973 g/cm3 |
|---|---|
| Molecular Formula | C9H12N2O7P2 |
| Molecular Weight | 322.14800 |
| Exact Mass | 322.01200 |
| PSA | 172.21000 |
| InChIKey | VMMKGHQPQIEGSQ-UHFFFAOYSA-N |
| SMILES | O=P(O)(O)C(O)(Cc1cnc2ccccn12)P(=O)(O)O |
| Storage condition | -20℃ |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |