N,N-Dimethyl-2,3,4,5,6-pentafluoroaniline structure
|
Common Name | N,N-Dimethyl-2,3,4,5,6-pentafluoroaniline | ||
|---|---|---|---|---|
| CAS Number | 1801-14-5 | Molecular Weight | 211.13200 | |
| Density | 1.422g/cm3 | Boiling Point | 186.5ºC at 760 mmHg | |
| Molecular Formula | C8H6F5N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 66.6ºC | |
| Name | 2,3,4,5,6-pentafluoro-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.422g/cm3 |
|---|---|
| Boiling Point | 186.5ºC at 760 mmHg |
| Molecular Formula | C8H6F5N |
| Molecular Weight | 211.13200 |
| Flash Point | 66.6ºC |
| Exact Mass | 211.04200 |
| PSA | 3.24000 |
| LogP | 2.44810 |
| Vapour Pressure | 0.662mmHg at 25°C |
| Index of Refraction | 1.458 |
| InChIKey | KGTLSNJIWZULPZ-UHFFFAOYSA-N |
| SMILES | CN(C)c1c(F)c(F)c(F)c(F)c1F |
| HS Code | 2921420090 |
|---|
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Benzenamine,2,3,4,5,6-pentafluoro-N,N-dimethyl |
| N,N-Dimethyl-2,3,4,5,6-pentafluoroaniline |
| N,N-dimethyl-pentafluoro-aniline |
| pentafluorophenyl-dimethylamine |