2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile structure
|
Common Name | 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile | ||
|---|---|---|---|---|
| CAS Number | 1801236-34-9 | Molecular Weight | 536.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H20N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C33H20N4O4 |
|---|---|
| Molecular Weight | 536.5 |
| InChIKey | FUJBLDKFHPEGTI-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1C#N)-c1cc(C#N)c(OC)cc1C21c2cc(OC)c(C#N)cc2-c2cc(C#N)c(OC)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile? |
| A: Molecular formula of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile is C33H20N4O4. |
| Q: What is the InChIKey of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile? |
| A: InChIKey of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile is FUJBLDKFHPEGTI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile? |
| A: CAS number of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile is 1801236-34-9. |
| Q: What is the SMILES notation of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile? |
| A: SMILES notation of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile is COc1cc2c(cc1C#N)-c1cc(C#N)c(OC)cc1C21c2cc(OC)c(C#N)cc2-c2cc(C#N)c(OC)cc21. |
| Q: What is the Chinese name of 1801236-34-9? |
| A: Chinese name of 1801236-34-9 is 1801236-34-9. |
| Q: What is the English name of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile? |
| A: The English name of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile is 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile. |
| Q: What is the molecular weight of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile? |
| A: Molecular weight of 2,2',7,7'-Tetramethoxy-9,9'-spirobi[fluorene]-3,3',6,6'-tetracarbonitrile is 536.5. |