5-Fluoro-AMP
Modify Date: 2025-09-09 21:22:26
5-Fluoro-AMP structure
|
Common Name | 5-Fluoro-AMP | ||
|---|---|---|---|---|
| CAS Number | 1801552-03-3 | Molecular Weight | 363.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26FN3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Fluoro-AMP |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H26FN3O3 |
|---|---|
| Molecular Weight | 363.4 |
| InChIKey | SAFXSUZMRLTBMM-INIZCTEOSA-N |
| SMILES | COC(=O)C(NC(=O)c1nn(CCCCCF)c2ccccc12)C(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 5-Fluoro-AMP? |
| A: CAS number of 5-Fluoro-AMP is 1801552-03-3. |
| Q: What is the molecular formula of 5-Fluoro-AMP? |
| A: Molecular formula of 5-Fluoro-AMP is C19H26FN3O3. |
| Q: What is the Chinese name of 1801552-03-3? |
| A: Chinese name of 1801552-03-3 is 1801552-03-3. |
| Q: What is the InChIKey of 5-Fluoro-AMP? |
| A: InChIKey of 5-Fluoro-AMP is SAFXSUZMRLTBMM-INIZCTEOSA-N. |
| Q: What is the SMILES notation of 5-Fluoro-AMP? |
| A: SMILES notation of 5-Fluoro-AMP is COC(=O)C(NC(=O)c1nn(CCCCCF)c2ccccc12)C(C)C. |
| Q: What is the English name of 5-Fluoro-AMP? |
| A: The English name of 5-Fluoro-AMP is 5-Fluoro-AMP. |
| Q: What is the molecular weight of 5-Fluoro-AMP? |
| A: Molecular weight of 5-Fluoro-AMP is 363.4. |