6-Chloro-3-piperidin-4-yl-1H-indole structure
|
Common Name | 6-Chloro-3-piperidin-4-yl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 180160-78-5 | Molecular Weight | 234.72500 | |
| Density | 1.229g/cm3 | Boiling Point | 419.037ºC at 760 mmHg | |
| Molecular Formula | C13H15ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.226ºC | |
| Name | 6-chloro-3-piperidin-4-yl-1h-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 419.037ºC at 760 mmHg |
| Molecular Formula | C13H15ClN2 |
| Molecular Weight | 234.72500 |
| Flash Point | 207.226ºC |
| Exact Mass | 234.09200 |
| PSA | 27.82000 |
| LogP | 3.61710 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.631 |
| InChIKey | UUUZYHSWCJGNBA-UHFFFAOYSA-N |
| SMILES | Clc1ccc2c(C3CCNCC3)c[nH]c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-chloro-3-(piperidine-4-yl)-1H-indole |
| 6-chloro-3-(4-piperidinyl)-1H-indole |
| 1H-Indole,6-chloro-3-(4-piperidinyl) |
| 6-Chloro-3-(piperidin-4-yl)-1H-indole |
| 6-chloranyl-3-piperidin-4-yl-1H-indole |