4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine
Modify Date: 2026-07-10 13:40:55
![4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine Structure](https://www.chemsrc.com/extcaspic/430/1801685-11-9.png)
4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine structure
|
Common Name | 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine | ||
|---|---|---|---|---|
| CAS Number | 1801685-11-9 | Molecular Weight | 229.05 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H6BrFN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C8H6BrFN2 |
|---|---|
| Molecular Weight | 229.05 |
| InChIKey | BWPZVHWMUXJTGU-UHFFFAOYSA-N |
| SMILES | Cc1ncc(Br)c2c(F)c[nH]c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine? |
| A: The English name of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine is 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine. |
| Q: What is the CAS number of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine? |
| A: CAS number of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine is 1801685-11-9. |
| Q: What is the molecular weight of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine? |
| A: Molecular weight of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine is 229.05. |
| Q: What is the InChIKey of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine? |
| A: InChIKey of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine is BWPZVHWMUXJTGU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1801685-11-9? |
| A: Chinese name of 1801685-11-9 is 1801685-11-9. |
| Q: What is the molecular formula of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine? |
| A: Molecular formula of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine is C8H6BrFN2. |
| Q: What is the SMILES notation of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine? |
| A: SMILES notation of 4-Bromo-3-fluoro-7-methyl-1H-pyrrolo[2,3-c]pyridine is Cc1ncc(Br)c2c(F)c[nH]c12. |