US10093646, Example 4
Modify Date: 2026-09-22 09:35:08
US10093646, Example 4 structure
|
Common Name | US10093646, Example 4 | ||
|---|---|---|---|---|
| CAS Number | 1801747-06-7 | Molecular Weight | 303.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | US10093646, Example 4 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H21N5S |
|---|---|
| Molecular Weight | 303.4 |
| InChIKey | RNJAZQWCWNYWQE-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2cnc(N3CCC(C)(N)CC3)nc2N)s1 |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: SHP2 Allosteric Inhibition Assay from US Patent US11401259: "1-Pyridazin-/triazin-3-y...
Source: BindingDB
Target: N/A
External Id: BindingDB_10726_1
|
|
Name: SHP2 Allosteric Inhibition Assay from US Patent US10093646: "1-pyridazin-/triazin-3-y...
Source: BindingDB
Target: N/A
External Id: BindingDB_745_1
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of US10093646, Example 4? |
| A: SMILES notation of US10093646, Example 4 is Cc1ccc(-c2cnc(N3CCC(C)(N)CC3)nc2N)s1. |
| Q: What is the CAS number of US10093646, Example 4? |
| A: CAS number of US10093646, Example 4 is 1801747-06-7. |
| Q: What is the English name of US10093646, Example 4? |
| A: The English name of US10093646, Example 4 is US10093646, Example 4. |
| Q: What is the Chinese name of 1801747-06-7? |
| A: Chinese name of 1801747-06-7 is 1801747-06-7. |
| Q: What is the InChIKey of US10093646, Example 4? |
| A: InChIKey of US10093646, Example 4 is RNJAZQWCWNYWQE-UHFFFAOYSA-N. |
| Q: What is the molecular weight of US10093646, Example 4? |
| A: Molecular weight of US10093646, Example 4 is 303.4. |
| Q: What is the molecular formula of US10093646, Example 4? |
| A: Molecular formula of US10093646, Example 4 is C15H21N5S. |