6-amino-1-ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazole structure
|
Common Name | 6-amino-1-ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazole | ||
|---|---|---|---|---|
| CAS Number | 18018-34-3 | Molecular Weight | 243.22800 | |
| Density | 1.37g/cm3 | Boiling Point | 377ºC at 760mmHg | |
| Molecular Formula | C11H12F3N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.8ºC | |
| Name | 6-amino-1-ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 377ºC at 760mmHg |
| Molecular Formula | C11H12F3N3 |
| Molecular Weight | 243.22800 |
| Flash Point | 181.8ºC |
| Exact Mass | 243.09800 |
| PSA | 43.84000 |
| LogP | 3.54680 |
| Vapour Pressure | 6.96E-06mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | CBCBTRZQTHHIST-UHFFFAOYSA-N |
| SMILES | CCn1c(C)nc2cc(C(F)(F)F)c(N)cc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethyl-2-methyl-6-trifluoromethyl-3H-benzoimidazol-5-ylamine |
| 1-Ethyl-2-methyl-5-(trifluoromethyl)-1H-benzimidazol-6-amine |
| 1H-Benzimidazol-6-amine,1-ethyl-2-methyl-5-(trifluoromethyl) |
| Einecs 241-930-9 |