(5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone
Modify Date: 2025-09-09 18:28:37
(5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone structure
|
Common Name | (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 1801907-41-4 | Molecular Weight | 277.07 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7BrF2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H7BrF2N2O |
|---|---|
| Molecular Weight | 277.07 |
| InChIKey | AAOJAECOGATTRR-UHFFFAOYSA-N |
| SMILES | O=C(c1cncc(Br)c1)N1CC(F)(F)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone? |
| A: SMILES notation of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone is O=C(c1cncc(Br)c1)N1CC(F)(F)C1. |
| Q: What is the InChIKey of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone? |
| A: InChIKey of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone is AAOJAECOGATTRR-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1801907-41-4? |
| A: Chinese name of 1801907-41-4 is 1801907-41-4. |
| Q: What is the molecular formula of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone? |
| A: Molecular formula of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone is C9H7BrF2N2O. |
| Q: What is the English name of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone? |
| A: The English name of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone is (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone. |
| Q: What is the molecular weight of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone? |
| A: Molecular weight of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone is 277.07. |
| Q: What is the CAS number of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone? |
| A: CAS number of (5-Bromopyridin-3-yl)(3,3-difluoroazetidin-1-yl)methanone is 1801907-41-4. |