3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride
Modify Date: 2026-07-15 18:28:20
3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride structure
|
Common Name | 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 1803561-06-9 | Molecular Weight | 178.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H7FN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C5H7FN2O2S |
|---|---|
| Molecular Weight | 178.19 |
| InChIKey | GWRDZQBFYKDLLP-UHFFFAOYSA-N |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride? |
| A: Molecular formula of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride is C5H7FN2O2S. |
| Q: What is the InChIKey of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride? |
| A: InChIKey of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride is GWRDZQBFYKDLLP-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1803561-06-9? |
| A: Chinese name of 1803561-06-9 is 1803561-06-9. |
| Q: What is the English name of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride? |
| A: The English name of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride is 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride. |
| Q: What is the molecular weight of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride? |
| A: Molecular weight of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride is 178.19. |
| Q: What is the SMILES notation of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride? |
| A: SMILES notation of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride is Cc1n[nH]c(C)c1S(=O)(=O)F. |
| Q: What is the CAS number of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride? |
| A: CAS number of 3,5-Dimethyl-1H-pyrazole-4-sulfonyl fluoride is 1803561-06-9. |