Methyl 4-bromo-2,2-diethyl-3-oxobutanoate
Modify Date: 2025-08-26 19:20:29
Methyl 4-bromo-2,2-diethyl-3-oxobutanoate structure
|
Common Name | Methyl 4-bromo-2,2-diethyl-3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 1803586-14-2 | Molecular Weight | 251.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H15BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-bromo-2,2-diethyl-3-oxobutanoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H15BrO3 |
|---|---|
| Molecular Weight | 251.12 |
| InChIKey | PLLDMXRMGKDOCK-UHFFFAOYSA-N |
| SMILES | CCC(CC)(C(=O)CBr)C(=O)OC |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate? |
| A: The English name of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate is Methyl 4-bromo-2,2-diethyl-3-oxobutanoate. |
| Q: What is the InChIKey of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate? |
| A: InChIKey of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate is PLLDMXRMGKDOCK-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate? |
| A: SMILES notation of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate is CCC(CC)(C(=O)CBr)C(=O)OC. |
| Q: What is the molecular weight of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate? |
| A: Molecular weight of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate is 251.12. |
| Q: What is the molecular formula of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate? |
| A: Molecular formula of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate is C9H15BrO3. |
| Q: What is the Chinese name of 1803586-14-2? |
| A: Chinese name of 1803586-14-2 is 1803586-14-2. |
| Q: What is the CAS number of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate? |
| A: CAS number of Methyl 4-bromo-2,2-diethyl-3-oxobutanoate is 1803586-14-2. |